C16H15BrCl2O — CID 66059500
2-[(3-bromophenyl)methyl]-3-(3,4-dichlorophenyl)propan-1-ol (PubChem CID 66059500) has the molecular formula C16H15BrCl2O and a molecular weight of 374.11 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-3-(3,4-dichlorophenyl)propan-1-ol.
| Compound Name | 2-[(3-bromophenyl)methyl]-3-(3,4-dichlorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 66059500 |
| Molecular Formula | C16H15BrCl2O |
| Molecular Weight | 374.11 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-3-(3,4-dichlorophenyl)propan-1-ol |
| SMILES | OCC(Cc1cccc(Br)c1)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H15BrCl2O/c17-14-3-1-2-11(8-14)6-13(10-20)7-12-4-5-15(18)16(19)9-12/h1-5,8-9,13,20H,6-7,10H2 |
| InChIKey | OVTURCFHRMNWPN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.11 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |