C16H14BrCl2F — CID 103042042
4-[2-[(3-bromophenyl)methyl]-3-chloropropyl]-2-chloro-1-fluorobenzene (PubChem CID 103042042) has the molecular formula C16H14BrCl2F and a molecular weight of 376.10 g/mol. Its IUPAC name is 4-[2-[(3-bromophenyl)methyl]-3-chloropropyl]-2-chloro-1-fluorobenzene.
| Compound Name | 4-[2-[(3-bromophenyl)methyl]-3-chloropropyl]-2-chloro-1-fluorobenzene |
|---|---|
| PubChem CID | 103042042 |
| Molecular Formula | C16H14BrCl2F |
| Molecular Weight | 376.10 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | 4-[2-[(3-bromophenyl)methyl]-3-chloropropyl]-2-chloro-1-fluorobenzene |
| SMILES | Fc1ccc(CC(CCl)Cc2cccc(Br)c2)cc1Cl |
| InChI | InChI=1S/C16H14BrCl2F/c17-14-3-1-2-11(8-14)6-13(10-18)7-12-4-5-16(20)15(19)9-12/h1-5,8-9,13H,6-7,10H2 |
| InChIKey | DJHQYNBFNBAAJU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.10 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|