C14H22BrN — CID 62601843
1-(3-bromophenyl)-5,5-dimethylhexan-2-amine (PubChem CID 62601843) has the molecular formula C14H22BrN and a molecular weight of 284.24 g/mol. Its IUPAC name is 1-(3-bromophenyl)-5,5-dimethylhexan-2-amine.
| Compound Name | 1-(3-bromophenyl)-5,5-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 62601843 |
| Molecular Formula | C14H22BrN |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 1-(3-bromophenyl)-5,5-dimethylhexan-2-amine |
| SMILES | CC(C)(C)CCC(N)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C14H22BrN/c1-14(2,3)8-7-13(16)10-11-5-4-6-12(15)9-11/h4-6,9,13H,7-8,10,16H2,1-3H3 |
| InChIKey | BAXXTUWMXCRMHQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |