C13H19BrO — CID 63015862
1-(3-bromophenyl)-4,4-dimethylpentan-2-ol (PubChem CID 63015862) has the molecular formula C13H19BrO and a molecular weight of 271.20 g/mol. Its IUPAC name is 1-(3-bromophenyl)-4,4-dimethylpentan-2-ol.
| Compound Name | 1-(3-bromophenyl)-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 63015862 |
| Molecular Formula | C13H19BrO |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 1-(3-bromophenyl)-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CC(O)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C13H19BrO/c1-13(2,3)9-12(15)8-10-5-4-6-11(14)7-10/h4-7,12,15H,8-9H2,1-3H3 |
| InChIKey | NTRNSZZKNGBUNO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |