C20H26BrN — CID 63496194
2-benzyl-3-(3-bromophenyl)-N-tert-butylpropan-1-amine (PubChem CID 63496194) has the molecular formula C20H26BrN and a molecular weight of 360.34 g/mol. Its IUPAC name is 2-benzyl-3-(3-bromophenyl)-N-tert-butylpropan-1-amine.
| Compound Name | 2-benzyl-3-(3-bromophenyl)-N-tert-butylpropan-1-amine |
|---|---|
| PubChem CID | 63496194 |
| Molecular Formula | C20H26BrN |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 2-benzyl-3-(3-bromophenyl)-N-tert-butylpropan-1-amine |
| SMILES | CC(C)(C)NCC(Cc1ccccc1)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C20H26BrN/c1-20(2,3)22-15-18(12-16-8-5-4-6-9-16)13-17-10-7-11-19(21)14-17/h4-11,14,18,22H,12-13,15H2,1-3H3 |
| InChIKey | NZWQRDSRNLBEAW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |