C15H24FN — CID 62516409
N-tert-butyl-2-[(3-fluorophenyl)methyl]butan-1-amine (PubChem CID 62516409) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is N-tert-butyl-2-[(3-fluorophenyl)methyl]butan-1-amine.
| Compound Name | N-tert-butyl-2-[(3-fluorophenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 62516409 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | N-tert-butyl-2-[(3-fluorophenyl)methyl]butan-1-amine |
| SMILES | CCC(CNC(C)(C)C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H24FN/c1-5-12(11-17-15(2,3)4)9-13-7-6-8-14(16)10-13/h6-8,10,12,17H,5,9,11H2,1-4H3 |
| InChIKey | UDQPOFVONZXART-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |