C18H33NSi — CID 106323236
N-tert-butyl-2-[(3-methylphenyl)methyl]-3-trimethylsilylpropan-1-amine (PubChem CID 106323236) has the molecular formula C18H33NSi and a molecular weight of 291.56 g/mol. Its IUPAC name is N-tert-butyl-2-[(3-methylphenyl)methyl]-3-trimethylsilylpropan-1-amine.
| Compound Name | N-tert-butyl-2-[(3-methylphenyl)methyl]-3-trimethylsilylpropan-1-amine |
|---|---|
| PubChem CID | 106323236 |
| Molecular Formula | C18H33NSi |
| Molecular Weight | 291.56 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | N-tert-butyl-2-[(3-methylphenyl)methyl]-3-trimethylsilylpropan-1-amine |
| SMILES | Cc1cccc(CC(CNC(C)(C)C)C[Si](C)(C)C)c1 |
| InChI | InChI=1S/C18H33NSi/c1-15-9-8-10-16(11-15)12-17(14-20(5,6)7)13-19-18(2,3)4/h8-11,17,19H,12-14H2,1-7H3 |
| InChIKey | JXFTYNRHTFVYKI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|