C18H24BrNO — CID 83178583
2-[(4-bromophenyl)methyl]-N-tert-butyl-3-(furan-3-yl)propan-1-amine (PubChem CID 83178583) has the molecular formula C18H24BrNO and a molecular weight of 350.30 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-N-tert-butyl-3-(furan-3-yl)propan-1-amine.
| Compound Name | 2-[(4-bromophenyl)methyl]-N-tert-butyl-3-(furan-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 83178583 |
| Molecular Formula | C18H24BrNO |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-N-tert-butyl-3-(furan-3-yl)propan-1-amine |
| SMILES | CC(C)(C)NCC(Cc1ccc(Br)cc1)Cc1ccoc1 |
| InChI | InChI=1S/C18H24BrNO/c1-18(2,3)20-12-16(11-15-8-9-21-13-15)10-14-4-6-17(19)7-5-14/h4-9,13,16,20H,10-12H2,1-3H3 |
| InChIKey | FDSCBNCEJJHIOV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |