C10H14FNO2S — CID 158527905
(2S)-3-(3-fluorophenyl)-2-(methylamino)propanoic acid;sulfane (PubChem CID 158527905) has the molecular formula C10H14FNO2S and a molecular weight of 231.29 g/mol. Its IUPAC name is (2S)-3-(3-fluorophenyl)-2-(methylamino)propanoic acid;sulfane.
| Compound Name | (2S)-3-(3-fluorophenyl)-2-(methylamino)propanoic acid;sulfane |
|---|---|
| PubChem CID | 158527905 |
| Molecular Formula | C10H14FNO2S |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | (2S)-3-(3-fluorophenyl)-2-(methylamino)propanoic acid;sulfane |
| SMILES | CN[C@@H](Cc1cccc(F)c1)C(=O)O.S |
| InChI | InChI=1S/C10H12FNO2.H2S/c1-12-9(10(13)14)6-7-3-2-4-8(11)5-7;/h2-5,9,12H,6H2,1H3,(H,13,14);1H2/t9-;/m0./s1 |
| InChIKey | HMZWKYSNWKVLHL-FVGYRXGTSA-N |
| XLogP | 1.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |