C34H33N3O4 — CID 102096506
methyl (E,2S,3S)-2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(2-methoxyphenyl)benzoyl]amino]-5-phenylpent-4-enoate (PubChem CID 102096506) has the molecular formula C34H33N3O4 and a molecular weight of 547.66 g/mol. Its IUPAC name is methyl (E,2S,3S)-2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(2-methoxyphenyl)benzoyl]amino]-5-phenylpent-4-enoate.
| Compound Name | methyl (E,2S,3S)-2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(2-methoxyphenyl)benzoyl]amino]-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 102096506 |
| Molecular Formula | C34H33N3O4 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | methyl (E,2S,3S)-2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(2-methoxyphenyl)benzoyl]amino]-5-phenylpent-4-enoate |
| SMILES | [H]/N=C(\N)c1cccc(C[C@H](C(=O)OC)[C@H](/C=C/c2ccccc2)NC(=O)c2ccc(-c3ccccc3OC)cc2)c1 |
| InChI | InChI=1S/C34H33N3O4/c1-40-31-14-7-6-13-28(31)25-16-18-26(19-17-25)33(38)37-30(20-15-23-9-4-3-5-10-23)29(34(39)41-2)22-24-11-8-12-27(21-24)32(35)36/h3-21,29-30H,22H2,1-2H3,(H3,35,36)(H,37,38)/b20-15+/t29-,30-/m0/s1 |
| InChIKey | AINQVQKSQFDZMT-XJEPXIRSSA-N |
| XLogP | 5.49 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|