C34H37AcN3O4 — CID 20707918
actinium;N-[1-(3-carbamimidoylphenyl)-2-(hydroxymethyl)-5-phenylpentan-3-yl]-4-(3,4-dimethoxyphenyl)benzamide (PubChem CID 20707918) has the molecular formula C34H37AcN3O4 and a molecular weight of 778.69 g/mol. Its IUPAC name is actinium;N-[1-(3-carbamimidoylphenyl)-2-(hydroxymethyl)-5-phenylpentan-3-yl]-4-(3,4-dimethoxyphenyl)benzamide.
| Compound Name | actinium;N-[1-(3-carbamimidoylphenyl)-2-(hydroxymethyl)-5-phenylpentan-3-yl]-4-(3,4-dimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 20707918 |
| Molecular Formula | C34H37AcN3O4 |
| Molecular Weight | 778.69 g/mol |
| Exact Mass | 778.31 |
| IUPAC Name | actinium;N-[1-(3-carbamimidoylphenyl)-2-(hydroxymethyl)-5-phenylpentan-3-yl]-4-(3,4-dimethoxyphenyl)benzamide |
| SMILES | [Ac].[H]/N=C(\N)c1cccc(CC(CO)C(CCc2ccccc2)NC(=O)c2ccc(-c3ccc(OC)c(OC)c3)cc2)c1 |
| InChI | InChI=1S/C34H37N3O4.Ac/c1-40-31-18-16-27(21-32(31)41-2)25-12-14-26(15-13-25)34(39)37-30(17-11-23-7-4-3-5-8-23)29(22-38)20-24-9-6-10-28(19-24)33(35)36;/h3-10,12-16,18-19,21,29-30,38H,11,17,20,22H2,1-2H3,(H3,35,36)(H,37,39); |
| InChIKey | YLIPHPRNWKODJX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.69 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|