C33H35N4O3+ — CID 54166335
methyl (2R)-2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(1-methylpyridin-1-ium-3-yl)benzoyl]amino]-5-phenylpentanoate (PubChem CID 54166335) has the molecular formula C33H35N4O3+ and a molecular weight of 535.67 g/mol. Its IUPAC name is methyl (2R)-2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(1-methylpyridin-1-ium-3-yl)benzoyl]amino]-5-phenylpentanoate.
| Compound Name | methyl (2R)-2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(1-methylpyridin-1-ium-3-yl)benzoyl]amino]-5-phenylpentanoate |
|---|---|
| PubChem CID | 54166335 |
| Molecular Formula | C33H35N4O3+ |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | methyl (2R)-2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(1-methylpyridin-1-ium-3-yl)benzoyl]amino]-5-phenylpentanoate |
| SMILES | [H]/N=C(\N)c1cccc(C[C@@H](C(=O)OC)C(CCc2ccccc2)NC(=O)c2ccc(-c3ccc[n+](C)c3)cc2)c1 |
| InChI | InChI=1S/C33H34N4O3/c1-37-19-7-12-28(22-37)25-14-16-26(17-15-25)32(38)36-30(18-13-23-8-4-3-5-9-23)29(33(39)40-2)21-24-10-6-11-27(20-24)31(34)35/h3-12,14-17,19-20,22,29-30H,13,18,21H2,1-2H3,(H3-,34,35,36,38)/p+1/t29-,30?/m1/s1 |
| InChIKey | ORXCKHICUADSLE-IDCGIGBZSA-O |
| XLogP | 4.23 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|