C34H33N3O3 — CID 10651783
methyl (E,2R,3R)-3-[(4-benzylbenzoyl)amino]-2-[(3-carbamimidoylphenyl)methyl]-5-phenylpent-4-enoate (PubChem CID 10651783) has the molecular formula C34H33N3O3 and a molecular weight of 531.66 g/mol. Its IUPAC name is methyl (E,2R,3R)-3-[(4-benzylbenzoyl)amino]-2-[(3-carbamimidoylphenyl)methyl]-5-phenylpent-4-enoate.
| Compound Name | methyl (E,2R,3R)-3-[(4-benzylbenzoyl)amino]-2-[(3-carbamimidoylphenyl)methyl]-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 10651783 |
| Molecular Formula | C34H33N3O3 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | methyl (E,2R,3R)-3-[(4-benzylbenzoyl)amino]-2-[(3-carbamimidoylphenyl)methyl]-5-phenylpent-4-enoate |
| SMILES | [H]/N=C(\N)c1cccc(C[C@@H](C(=O)OC)[C@@H](/C=C/c2ccccc2)NC(=O)c2ccc(Cc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C34H33N3O3/c1-40-34(39)30(23-27-13-8-14-29(22-27)32(35)36)31(20-17-24-9-4-2-5-10-24)37-33(38)28-18-15-26(16-19-28)21-25-11-6-3-7-12-25/h2-20,22,30-31H,21,23H2,1H3,(H3,35,36)(H,37,38)/b20-17+/t30-,31-/m1/s1 |
| InChIKey | XLNGIGRIGVQMIN-IDWATVSYSA-N |
| XLogP | 5.41 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|