C26H31ClN4O4 — CID 157270777
methane;methyl (3R)-2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(1-oxidopyridin-1-ium-4-yl)benzoyl]amino]butanoate;hydrochloride (PubChem CID 157270777) has the molecular formula C26H31ClN4O4 and a molecular weight of 499.01 g/mol. Its IUPAC name is methane;methyl (3R)-2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(1-oxidopyridin-1-ium-4-yl)benzoyl]amino]butanoate;hydrochloride.
| Compound Name | methane;methyl (3R)-2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(1-oxidopyridin-1-ium-4-yl)benzoyl]amino]butanoate;hydrochloride |
|---|---|
| PubChem CID | 157270777 |
| Molecular Formula | C26H31ClN4O4 |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | methane;methyl (3R)-2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(1-oxidopyridin-1-ium-4-yl)benzoyl]amino]butanoate;hydrochloride |
| SMILES | C.Cl.[H]/N=C(\N)c1cccc(CC(C(=O)OC)[C@@H](C)NC(=O)c2ccc(-c3cc[n+]([O-])cc3)cc2)c1 |
| InChI | InChI=1S/C25H26N4O4.CH4.ClH/c1-16(22(25(31)33-2)15-17-4-3-5-21(14-17)23(26)27)28-24(30)20-8-6-18(7-9-20)19-10-12-29(32)13-11-19;;/h3-14,16,22H,15H2,1-2H3,(H3,26,27)(H,28,30);1H4;1H/t16-,22?;;/m1../s1 |
| InChIKey | UJOBLSZYIZHCDT-NMRSIFPMSA-N |
| XLogP | 3.48 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|