C29H27N3O3 — CID 20708090
methyl 3-benzamido-2-[(3-carbamimidoylphenyl)methyl]-3-naphthalen-2-ylpropanoate (PubChem CID 20708090) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is methyl 3-benzamido-2-[(3-carbamimidoylphenyl)methyl]-3-naphthalen-2-ylpropanoate.
| Compound Name | methyl 3-benzamido-2-[(3-carbamimidoylphenyl)methyl]-3-naphthalen-2-ylpropanoate |
|---|---|
| PubChem CID | 20708090 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | methyl 3-benzamido-2-[(3-carbamimidoylphenyl)methyl]-3-naphthalen-2-ylpropanoate |
| SMILES | [H]/N=C(\N)c1cccc(CC(C(=O)OC)C(NC(=O)c2ccccc2)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C29H27N3O3/c1-35-29(34)25(17-19-8-7-13-24(16-19)27(30)31)26(32-28(33)21-10-3-2-4-11-21)23-15-14-20-9-5-6-12-22(20)18-23/h2-16,18,25-26H,17H2,1H3,(H3,30,31)(H,32,33) |
| InChIKey | YKJIMYYKAIOKAU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|