C27H32N4O4 — CID 147814005
methyl 3-[[[4-[3-(aminomethyl)phenyl]phenyl]-hydroxymethyl]amino]-2-[(3-carbamimidoylphenyl)methyl]-4-hydroxybutanoate (PubChem CID 147814005) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is methyl 3-[[[4-[3-(aminomethyl)phenyl]phenyl]-hydroxymethyl]amino]-2-[(3-carbamimidoylphenyl)methyl]-4-hydroxybutanoate.
| Compound Name | methyl 3-[[[4-[3-(aminomethyl)phenyl]phenyl]-hydroxymethyl]amino]-2-[(3-carbamimidoylphenyl)methyl]-4-hydroxybutanoate |
|---|---|
| PubChem CID | 147814005 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | methyl 3-[[[4-[3-(aminomethyl)phenyl]phenyl]-hydroxymethyl]amino]-2-[(3-carbamimidoylphenyl)methyl]-4-hydroxybutanoate |
| SMILES | [H]/N=C(\N)c1cccc(CC(C(=O)OC)C(CO)NC(O)c2ccc(-c3cccc(CN)c3)cc2)c1 |
| InChI | InChI=1S/C27H32N4O4/c1-35-27(34)23(14-17-4-2-7-22(12-17)25(29)30)24(16-32)31-26(33)20-10-8-19(9-11-20)21-6-3-5-18(13-21)15-28/h2-13,23-24,26,31-33H,14-16,28H2,1H3,(H3,29,30) |
| InChIKey | HNYAQTKDAFPDBU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 154.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|