C32H33N3O2 — CID 20707983
N-[3-[[3-(1-aminoethenyl)phenyl]methyl]-4-hydroxy-1-phenylbutan-2-yl]-4-(4-aminophenyl)benzamide (PubChem CID 20707983) has the molecular formula C32H33N3O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is N-[3-[[3-(1-aminoethenyl)phenyl]methyl]-4-hydroxy-1-phenylbutan-2-yl]-4-(4-aminophenyl)benzamide.
| Compound Name | N-[3-[[3-(1-aminoethenyl)phenyl]methyl]-4-hydroxy-1-phenylbutan-2-yl]-4-(4-aminophenyl)benzamide |
|---|---|
| PubChem CID | 20707983 |
| Molecular Formula | C32H33N3O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | N-[3-[[3-(1-aminoethenyl)phenyl]methyl]-4-hydroxy-1-phenylbutan-2-yl]-4-(4-aminophenyl)benzamide |
| SMILES | C=C(N)c1cccc(CC(CO)C(Cc2ccccc2)NC(=O)c2ccc(-c3ccc(N)cc3)cc2)c1 |
| InChI | InChI=1S/C32H33N3O2/c1-22(33)28-9-5-8-24(18-28)19-29(21-36)31(20-23-6-3-2-4-7-23)35-32(37)27-12-10-25(11-13-27)26-14-16-30(34)17-15-26/h2-18,29,31,36H,1,19-21,33-34H2,(H,35,37) |
| InChIKey | CNASNQIHRXHMIE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|