C17H19NO3 — CID 15293513
N-[(2S,3R)-3,4-dihydroxy-1-phenylbutan-2-yl]benzamide (PubChem CID 15293513) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is N-[(2S,3R)-3,4-dihydroxy-1-phenylbutan-2-yl]benzamide.
| Compound Name | N-[(2S,3R)-3,4-dihydroxy-1-phenylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 15293513 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-[(2S,3R)-3,4-dihydroxy-1-phenylbutan-2-yl]benzamide |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@@H](O)CO)c1ccccc1 |
| InChI | InChI=1S/C17H19NO3/c19-12-16(20)15(11-13-7-3-1-4-8-13)18-17(21)14-9-5-2-6-10-14/h1-10,15-16,19-20H,11-12H2,(H,18,21)/t15-,16-/m0/s1 |
| InChIKey | XUICYYVXTNRVRZ-HOTGVXAUSA-N |
| XLogP | 1.38 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |