C17H17NO5 — CID 123353160
2-[(1,1-dihydroxy-3-phenylpropan-2-yl)carbamoyl]benzoic acid (PubChem CID 123353160) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-[(1,1-dihydroxy-3-phenylpropan-2-yl)carbamoyl]benzoic acid.
| Compound Name | 2-[(1,1-dihydroxy-3-phenylpropan-2-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 123353160 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[(1,1-dihydroxy-3-phenylpropan-2-yl)carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)NC(Cc1ccccc1)C(O)O |
| InChI | InChI=1S/C17H17NO5/c19-15(12-8-4-5-9-13(12)16(20)21)18-14(17(22)23)10-11-6-2-1-3-7-11/h1-9,14,17,22-23H,10H2,(H,18,19)(H,20,21) |
| InChIKey | RBXBELFWXJMKFZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|