C24H20FNO6 — CID 71073713
2-[5-[(1-carboxy-1-hydroxy-3-phenylpropan-2-yl)carbamoyl]-2-fluorophenyl]benzoic acid (PubChem CID 71073713) has the molecular formula C24H20FNO6 and a molecular weight of 437.42 g/mol. Its IUPAC name is 2-[5-[(1-carboxy-1-hydroxy-3-phenylpropan-2-yl)carbamoyl]-2-fluorophenyl]benzoic acid.
| Compound Name | 2-[5-[(1-carboxy-1-hydroxy-3-phenylpropan-2-yl)carbamoyl]-2-fluorophenyl]benzoic acid |
|---|---|
| PubChem CID | 71073713 |
| Molecular Formula | C24H20FNO6 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 2-[5-[(1-carboxy-1-hydroxy-3-phenylpropan-2-yl)carbamoyl]-2-fluorophenyl]benzoic acid |
| SMILES | O=C(NC(Cc1ccccc1)C(O)C(=O)O)c1ccc(F)c(-c2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C24H20FNO6/c25-19-11-10-15(13-18(19)16-8-4-5-9-17(16)23(29)30)22(28)26-20(21(27)24(31)32)12-14-6-2-1-3-7-14/h1-11,13,20-21,27H,12H2,(H,26,28)(H,29,30)(H,31,32) |
| InChIKey | UMWDFONHMVVXNT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |