C19H19BrFNO4 — CID 71073975
ethyl (2R,3R)-3-[(3-bromo-4-fluorobenzoyl)amino]-2-hydroxy-4-phenylbutanoate (PubChem CID 71073975) has the molecular formula C19H19BrFNO4 and a molecular weight of 424.27 g/mol. Its IUPAC name is ethyl (2R,3R)-3-[(3-bromo-4-fluorobenzoyl)amino]-2-hydroxy-4-phenylbutanoate.
| Compound Name | ethyl (2R,3R)-3-[(3-bromo-4-fluorobenzoyl)amino]-2-hydroxy-4-phenylbutanoate |
|---|---|
| PubChem CID | 71073975 |
| Molecular Formula | C19H19BrFNO4 |
| Molecular Weight | 424.27 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | ethyl (2R,3R)-3-[(3-bromo-4-fluorobenzoyl)amino]-2-hydroxy-4-phenylbutanoate |
| SMILES | CCOC(=O)[C@H](O)[C@@H](Cc1ccccc1)NC(=O)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C19H19BrFNO4/c1-2-26-19(25)17(23)16(10-12-6-4-3-5-7-12)22-18(24)13-8-9-15(21)14(20)11-13/h3-9,11,16-17,23H,2,10H2,1H3,(H,22,24)/t16-,17-/m1/s1 |
| InChIKey | KVKCZTZRCGENPI-IAGOWNOFSA-N |
| XLogP | 2.85 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |