C12H10BrFO4 — CID 62915178
ethyl 4-(3-bromo-4-fluorophenyl)-2,4-dioxobutanoate (PubChem CID 62915178) has the molecular formula C12H10BrFO4 and a molecular weight of 317.11 g/mol. Its IUPAC name is ethyl 4-(3-bromo-4-fluorophenyl)-2,4-dioxobutanoate.
| Compound Name | ethyl 4-(3-bromo-4-fluorophenyl)-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 62915178 |
| Molecular Formula | C12H10BrFO4 |
| Molecular Weight | 317.11 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | ethyl 4-(3-bromo-4-fluorophenyl)-2,4-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)CC(=O)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C12H10BrFO4/c1-2-18-12(17)11(16)6-10(15)7-3-4-9(14)8(13)5-7/h3-5H,2,6H2,1H3 |
| InChIKey | FEAIBQQGGQUSOA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.11 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|