C16H12BrFO2 — CID 62914265
1-(3-bromo-4-fluorophenyl)-3-(4-methylphenyl)propane-1,3-dione (PubChem CID 62914265) has the molecular formula C16H12BrFO2 and a molecular weight of 335.17 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-3-(4-methylphenyl)propane-1,3-dione.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-3-(4-methylphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 62914265 |
| Molecular Formula | C16H12BrFO2 |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-3-(4-methylphenyl)propane-1,3-dione |
| SMILES | Cc1ccc(C(=O)CC(=O)c2ccc(F)c(Br)c2)cc1 |
| InChI | InChI=1S/C16H12BrFO2/c1-10-2-4-11(5-3-10)15(19)9-16(20)12-6-7-14(18)13(17)8-12/h2-8H,9H2,1H3 |
| InChIKey | PQJLJLOKQNMUPH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|