C15H12BrFO3 — CID 62913901
1-(3-bromo-4-fluorophenyl)-3-(2,5-dimethylfuran-3-yl)propane-1,3-dione (PubChem CID 62913901) has the molecular formula C15H12BrFO3 and a molecular weight of 339.16 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-3-(2,5-dimethylfuran-3-yl)propane-1,3-dione.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-3-(2,5-dimethylfuran-3-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 62913901 |
| Molecular Formula | C15H12BrFO3 |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-3-(2,5-dimethylfuran-3-yl)propane-1,3-dione |
| SMILES | Cc1cc(C(=O)CC(=O)c2ccc(F)c(Br)c2)c(C)o1 |
| InChI | InChI=1S/C15H12BrFO3/c1-8-5-11(9(2)20-8)15(19)7-14(18)10-3-4-13(17)12(16)6-10/h3-6H,7H2,1-2H3 |
| InChIKey | SHKXMMSJEQIINF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|