C15H13BrO3 — CID 43321253
1-(3-bromophenyl)-3-(2,5-dimethylfuran-3-yl)propane-1,3-dione (PubChem CID 43321253) has the molecular formula C15H13BrO3 and a molecular weight of 321.17 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(2,5-dimethylfuran-3-yl)propane-1,3-dione.
| Compound Name | 1-(3-bromophenyl)-3-(2,5-dimethylfuran-3-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 43321253 |
| Molecular Formula | C15H13BrO3 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 1-(3-bromophenyl)-3-(2,5-dimethylfuran-3-yl)propane-1,3-dione |
| SMILES | Cc1cc(C(=O)CC(=O)c2cccc(Br)c2)c(C)o1 |
| InChI | InChI=1S/C15H13BrO3/c1-9-6-13(10(2)19-9)15(18)8-14(17)11-4-3-5-12(16)7-11/h3-7H,8H2,1-2H3 |
| InChIKey | TYIXODPUJZJZHM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|