C12H13BrO4 — CID 62745023
1-(3-bromophenyl)-4,4-dimethoxybutane-1,3-dione (PubChem CID 62745023) has the molecular formula C12H13BrO4 and a molecular weight of 301.14 g/mol. Its IUPAC name is 1-(3-bromophenyl)-4,4-dimethoxybutane-1,3-dione.
| Compound Name | 1-(3-bromophenyl)-4,4-dimethoxybutane-1,3-dione |
|---|---|
| PubChem CID | 62745023 |
| Molecular Formula | C12H13BrO4 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 1-(3-bromophenyl)-4,4-dimethoxybutane-1,3-dione |
| SMILES | COC(OC)C(=O)CC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H13BrO4/c1-16-12(17-2)11(15)7-10(14)8-4-3-5-9(13)6-8/h3-6,12H,7H2,1-2H3 |
| InChIKey | ZAEHCSPQHQDLIM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|