C13H15BrO4 — CID 114079049
1-(3-bromophenyl)-4,4-dimethoxy-2-methylbutane-1,3-dione (PubChem CID 114079049) has the molecular formula C13H15BrO4 and a molecular weight of 315.16 g/mol. Its IUPAC name is 1-(3-bromophenyl)-4,4-dimethoxy-2-methylbutane-1,3-dione.
| Compound Name | 1-(3-bromophenyl)-4,4-dimethoxy-2-methylbutane-1,3-dione |
|---|---|
| PubChem CID | 114079049 |
| Molecular Formula | C13H15BrO4 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 1-(3-bromophenyl)-4,4-dimethoxy-2-methylbutane-1,3-dione |
| SMILES | COC(OC)C(=O)C(C)C(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H15BrO4/c1-8(12(16)13(17-2)18-3)11(15)9-5-4-6-10(14)7-9/h4-8,13H,1-3H3 |
| InChIKey | VFXZWQGOVJKHPX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|