C12H13BrO3 — CID 79413670
4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 79413670) has the molecular formula C12H13BrO3 and a molecular weight of 285.14 g/mol. Its IUPAC name is 4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 79413670 |
| Molecular Formula | C12H13BrO3 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C(=O)O)C(C)C(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H13BrO3/c1-7(8(2)12(15)16)11(14)9-4-3-5-10(13)6-9/h3-8H,1-2H3,(H,15,16) |
| InChIKey | FVEDMNKDBXHNRP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |