4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid

C12H13BrO3 — CID 79413670

IUPAC4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid
SMILESCC(C(=O)O)C(C)C(=O)c1cccc(Br)c1
InChIInChI=1S/C12H13BrO3/c1-7(8(2)12(15)16)11(14)9-4-3-5-10(13)6-9/h3-8H,1-2H3,(H,15,16)
InChIKeyFVEDMNKDBXHNRP-UHFFFAOYSA-N
MW285.14 g/mol
LogP2.99
Rot. Bonds4

About 4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid

4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 79413670) has the molecular formula C12H13BrO3 and a molecular weight of 285.14 g/mol. Its IUPAC name is 4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid
PubChem CID79413670
Molecular FormulaC12H13BrO3
Molecular Weight285.14 g/mol
Exact Mass284.00
IUPAC Name4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid
SMILESCC(C(=O)O)C(C)C(=O)c1cccc(Br)c1
InChIInChI=1S/C12H13BrO3/c1-7(8(2)12(15)16)11(14)9-4-3-5-10(13)6-9/h3-8H,1-2H3,(H,15,16)
InChIKeyFVEDMNKDBXHNRP-UHFFFAOYSA-N
XLogP2.99
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.14
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid (CID 79413670) is 4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid is CC(C(=O)O)C(C)C(=O)c1cccc(Br)c1.
What is the InChIKey of 4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid?
The InChIKey is FVEDMNKDBXHNRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrO3/c1-7(8(2)12(15)16)11(14)9-4-3-5-10(13)6-9/h3-8H,1-2H3,(H,15,16).
What are the key properties of 4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid?
4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid has a molecular weight of 285.14 g/mol, XLogP of 2.99, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromophenyl)-2,3-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 79413670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).