C8H5BrF2O — CID 86650253
1-(3-bromophenyl)-2,2-difluoroethanone (PubChem CID 86650253) has the molecular formula C8H5BrF2O and a molecular weight of 235.03 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2,2-difluoroethanone.
| Compound Name | 1-(3-bromophenyl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 86650253 |
| Molecular Formula | C8H5BrF2O |
| Molecular Weight | 235.03 g/mol |
| Exact Mass | 233.95 |
| IUPAC Name | 1-(3-bromophenyl)-2,2-difluoroethanone |
| SMILES | O=C(c1cccc(Br)c1)C(F)F |
| InChI | InChI=1S/C8H5BrF2O/c9-6-3-1-2-5(4-6)7(12)8(10)11/h1-4,8H |
| InChIKey | HZELFBPCXLKNMP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.03 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |