C9H6BrF2NO2 — CID 150582238
[1-(3-bromophenyl)-2,2-difluoroethylidene]carbamic acid (PubChem CID 150582238) has the molecular formula C9H6BrF2NO2 and a molecular weight of 278.05 g/mol. Its IUPAC name is [1-(3-bromophenyl)-2,2-difluoroethylidene]carbamic acid.
| Compound Name | [1-(3-bromophenyl)-2,2-difluoroethylidene]carbamic acid |
|---|---|
| PubChem CID | 150582238 |
| Molecular Formula | C9H6BrF2NO2 |
| Molecular Weight | 278.05 g/mol |
| Exact Mass | 276.95 |
| IUPAC Name | [1-(3-bromophenyl)-2,2-difluoroethylidene]carbamic acid |
| SMILES | O=C(O)N=C(c1cccc(Br)c1)C(F)F |
| InChI | InChI=1S/C9H6BrF2NO2/c10-6-3-1-2-5(4-6)7(8(11)12)13-9(14)15/h1-4,8H,(H,14,15) |
| InChIKey | IOBTWUPAAQYLJE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.05 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|