C8H5BrCl2O — CID 15937137
1-(3-bromophenyl)-2,2-dichloroethanone (PubChem CID 15937137) has the molecular formula C8H5BrCl2O and a molecular weight of 267.94 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2,2-dichloroethanone.
| Compound Name | 1-(3-bromophenyl)-2,2-dichloroethanone |
|---|---|
| PubChem CID | 15937137 |
| Molecular Formula | C8H5BrCl2O |
| Molecular Weight | 267.94 g/mol |
| Exact Mass | 265.89 |
| IUPAC Name | 1-(3-bromophenyl)-2,2-dichloroethanone |
| SMILES | O=C(c1cccc(Br)c1)C(Cl)Cl |
| InChI | InChI=1S/C8H5BrCl2O/c9-6-3-1-2-5(4-6)7(12)8(10)11/h1-4,8H |
| InChIKey | IFZFEXDFJOQPNR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.94 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|