C13H14BrF2NO2 — CID 86650254
tert-butyl N-[1-(3-bromophenyl)-2,2-difluoroethylidene]carbamate (PubChem CID 86650254) has the molecular formula C13H14BrF2NO2 and a molecular weight of 334.16 g/mol. Its IUPAC name is tert-butyl N-[1-(3-bromophenyl)-2,2-difluoroethylidene]carbamate.
| Compound Name | tert-butyl N-[1-(3-bromophenyl)-2,2-difluoroethylidene]carbamate |
|---|---|
| PubChem CID | 86650254 |
| Molecular Formula | C13H14BrF2NO2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | tert-butyl N-[1-(3-bromophenyl)-2,2-difluoroethylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=C(c1cccc(Br)c1)C(F)F |
| InChI | InChI=1S/C13H14BrF2NO2/c1-13(2,3)19-12(18)17-10(11(15)16)8-5-4-6-9(14)7-8/h4-7,11H,1-3H3 |
| InChIKey | RLCILHHSNDGIKZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|