C10H12O4 — CID 19101529
1-(3-hydroxyphenyl)-2,2-dimethoxyethanone (PubChem CID 19101529) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 1-(3-hydroxyphenyl)-2,2-dimethoxyethanone.
| Compound Name | 1-(3-hydroxyphenyl)-2,2-dimethoxyethanone |
|---|---|
| PubChem CID | 19101529 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-(3-hydroxyphenyl)-2,2-dimethoxyethanone |
| SMILES | COC(OC)C(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C10H12O4/c1-13-10(14-2)9(12)7-4-3-5-8(11)6-7/h3-6,10-11H,1-2H3 |
| InChIKey | DQFHAKHNSMPFOJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|