C10H12O4 — CID 22382756
2,4-dihydroxy-1-(3-hydroxyphenyl)butan-1-one (PubChem CID 22382756) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 2,4-dihydroxy-1-(3-hydroxyphenyl)butan-1-one.
| Compound Name | 2,4-dihydroxy-1-(3-hydroxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 22382756 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2,4-dihydroxy-1-(3-hydroxyphenyl)butan-1-one |
| SMILES | O=C(c1cccc(O)c1)C(O)CCO |
| InChI | InChI=1S/C10H12O4/c11-5-4-9(13)10(14)7-2-1-3-8(12)6-7/h1-3,6,9,11-13H,4-5H2 |
| InChIKey | SPYRRBMYESBPDO-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |