C11H15NO4 — CID 60653076
N-(2,2-dimethoxyethyl)-3-hydroxybenzamide (PubChem CID 60653076) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3-hydroxybenzamide.
| Compound Name | N-(2,2-dimethoxyethyl)-3-hydroxybenzamide |
|---|---|
| PubChem CID | 60653076 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3-hydroxybenzamide |
| SMILES | COC(CNC(=O)c1cccc(O)c1)OC |
| InChI | InChI=1S/C11H15NO4/c1-15-10(16-2)7-12-11(14)8-4-3-5-9(13)6-8/h3-6,10,13H,7H2,1-2H3,(H,12,14) |
| InChIKey | HCRGDPQFHDOEEA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|