C10H12O4 — CID 79679462
methyl 3-(2,5-dimethylfuran-3-yl)-3-oxopropanoate (PubChem CID 79679462) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is methyl 3-(2,5-dimethylfuran-3-yl)-3-oxopropanoate.
| Compound Name | methyl 3-(2,5-dimethylfuran-3-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 79679462 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | methyl 3-(2,5-dimethylfuran-3-yl)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C10H12O4/c1-6-4-8(7(2)14-6)9(11)5-10(12)13-3/h4H,5H2,1-3H3 |
| InChIKey | JGYRNOKGPXYAGS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|