methyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate

C13H19NO4 — CID 54942114

IUPACmethyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate
SMILESCOC(=O)CN(C(=O)c1cc(C)oc1C)C(C)C
InChIInChI=1S/C13H19NO4/c1-8(2)14(7-12(15)17-5)13(16)11-6-9(3)18-10(11)4/h6,8H,7H2,1-5H3
InChIKeyLFCMYINIPSDKKT-UHFFFAOYSA-N
MW253.30 g/mol
LogP1.92
Rot. Bonds4

About methyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate

methyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate (PubChem CID 54942114) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is methyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate.

Molecular Properties

Compound Namemethyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate
PubChem CID54942114
Molecular FormulaC13H19NO4
Molecular Weight253.30 g/mol
Exact Mass253.13
IUPAC Namemethyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate
SMILESCOC(=O)CN(C(=O)c1cc(C)oc1C)C(C)C
InChIInChI=1S/C13H19NO4/c1-8(2)14(7-12(15)17-5)13(16)11-6-9(3)18-10(11)4/h6,8H,7H2,1-5H3
InChIKeyLFCMYINIPSDKKT-UHFFFAOYSA-N
XLogP1.92
TPSA59.75 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.30
LogP ≤ 51.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate?
The IUPAC name of methyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate (CID 54942114) is methyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate.
What is the SMILES notation for methyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate?
The canonical SMILES for methyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate is COC(=O)CN(C(=O)c1cc(C)oc1C)C(C)C.
What is the InChIKey of methyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate?
The InChIKey is LFCMYINIPSDKKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO4/c1-8(2)14(7-12(15)17-5)13(16)11-6-9(3)18-10(11)4/h6,8H,7H2,1-5H3.
What are the key properties of methyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate?
methyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate has a molecular weight of 253.30 g/mol, XLogP of 1.92, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,5-dimethylfuran-3-carbonyl)-propan-2-ylamino]acetate is sourced from PubChem (CID 54942114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).