C15H25NO2 — CID 86978108
2,5-dimethyl-N,N-bis(2-methylpropyl)furan-3-carboxamide (PubChem CID 86978108) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 2,5-dimethyl-N,N-bis(2-methylpropyl)furan-3-carboxamide.
| Compound Name | 2,5-dimethyl-N,N-bis(2-methylpropyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 86978108 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2,5-dimethyl-N,N-bis(2-methylpropyl)furan-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(CC(C)C)CC(C)C)c(C)o1 |
| InChI | InChI=1S/C15H25NO2/c1-10(2)8-16(9-11(3)4)15(17)14-7-12(5)18-13(14)6/h7,10-11H,8-9H2,1-6H3 |
| InChIKey | UUGOVZRQEWDGKF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |