C12H18BrNO2 — CID 80666211
N-(2-bromoethyl)-2,5-dimethyl-N-propan-2-ylfuran-3-carboxamide (PubChem CID 80666211) has the molecular formula C12H18BrNO2 and a molecular weight of 288.19 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,5-dimethyl-N-propan-2-ylfuran-3-carboxamide.
| Compound Name | N-(2-bromoethyl)-2,5-dimethyl-N-propan-2-ylfuran-3-carboxamide |
|---|---|
| PubChem CID | 80666211 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | N-(2-bromoethyl)-2,5-dimethyl-N-propan-2-ylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(CCBr)C(C)C)c(C)o1 |
| InChI | InChI=1S/C12H18BrNO2/c1-8(2)14(6-5-13)12(15)11-7-9(3)16-10(11)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | SACAOHSEIDFZJO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|