C14H22BrNO2 — CID 80662981
N-(3-bromopropyl)-2,4,5-trimethyl-N-propan-2-ylfuran-3-carboxamide (PubChem CID 80662981) has the molecular formula C14H22BrNO2 and a molecular weight of 316.24 g/mol. Its IUPAC name is N-(3-bromopropyl)-2,4,5-trimethyl-N-propan-2-ylfuran-3-carboxamide.
| Compound Name | N-(3-bromopropyl)-2,4,5-trimethyl-N-propan-2-ylfuran-3-carboxamide |
|---|---|
| PubChem CID | 80662981 |
| Molecular Formula | C14H22BrNO2 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | N-(3-bromopropyl)-2,4,5-trimethyl-N-propan-2-ylfuran-3-carboxamide |
| SMILES | Cc1oc(C)c(C(=O)N(CCCBr)C(C)C)c1C |
| InChI | InChI=1S/C14H22BrNO2/c1-9(2)16(8-6-7-15)14(17)13-10(3)11(4)18-12(13)5/h9H,6-8H2,1-5H3 |
| InChIKey | YYWIRBGVCHMNNU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|