C18H23NO2 — CID 134025956
N-benzyl-N-butan-2-yl-2,5-dimethylfuran-3-carboxamide (PubChem CID 134025956) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-benzyl-N-butan-2-yl-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-benzyl-N-butan-2-yl-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 134025956 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-benzyl-N-butan-2-yl-2,5-dimethylfuran-3-carboxamide |
| SMILES | CCC(C)N(Cc1ccccc1)C(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C18H23NO2/c1-5-13(2)19(12-16-9-7-6-8-10-16)18(20)17-11-14(3)21-15(17)4/h6-11,13H,5,12H2,1-4H3 |
| InChIKey | VPTKFKAIQQQQSH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |