C19H24N2O — CID 55875368
N-benzyl-N-butan-2-yl-2,6-dimethylpyridine-3-carboxamide (PubChem CID 55875368) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is N-benzyl-N-butan-2-yl-2,6-dimethylpyridine-3-carboxamide.
| Compound Name | N-benzyl-N-butan-2-yl-2,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 55875368 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | N-benzyl-N-butan-2-yl-2,6-dimethylpyridine-3-carboxamide |
| SMILES | CCC(C)N(Cc1ccccc1)C(=O)c1ccc(C)nc1C |
| InChI | InChI=1S/C19H24N2O/c1-5-15(3)21(13-17-9-7-6-8-10-17)19(22)18-12-11-14(2)20-16(18)4/h6-12,15H,5,13H2,1-4H3 |
| InChIKey | IXVAKSGEYDCDDA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |