C13H16Cl2N2O3 — CID 107184293
methyl 2-[(5-amino-2,3-dichlorobenzoyl)-propan-2-ylamino]acetate (PubChem CID 107184293) has the molecular formula C13H16Cl2N2O3 and a molecular weight of 319.19 g/mol. Its IUPAC name is methyl 2-[(5-amino-2,3-dichlorobenzoyl)-propan-2-ylamino]acetate.
| Compound Name | methyl 2-[(5-amino-2,3-dichlorobenzoyl)-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 107184293 |
| Molecular Formula | C13H16Cl2N2O3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | methyl 2-[(5-amino-2,3-dichlorobenzoyl)-propan-2-ylamino]acetate |
| SMILES | COC(=O)CN(C(=O)c1cc(N)cc(Cl)c1Cl)C(C)C |
| InChI | InChI=1S/C13H16Cl2N2O3/c1-7(2)17(6-11(18)20-3)13(19)9-4-8(16)5-10(14)12(9)15/h4-5,7H,6,16H2,1-3H3 |
| InChIKey | NLHOUIKCGCWQIC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|