C12H18N2O6S — CID 120518391
2-[[2-methyl-5-(methylsulfamoyl)furan-3-carbonyl]-propan-2-ylamino]acetic acid (PubChem CID 120518391) has the molecular formula C12H18N2O6S and a molecular weight of 318.35 g/mol. Its IUPAC name is 2-[[2-methyl-5-(methylsulfamoyl)furan-3-carbonyl]-propan-2-ylamino]acetic acid.
| Compound Name | 2-[[2-methyl-5-(methylsulfamoyl)furan-3-carbonyl]-propan-2-ylamino]acetic acid |
|---|---|
| PubChem CID | 120518391 |
| Molecular Formula | C12H18N2O6S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-[[2-methyl-5-(methylsulfamoyl)furan-3-carbonyl]-propan-2-ylamino]acetic acid |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N(CC(=O)O)C(C)C)c(C)o1 |
| InChI | InChI=1S/C12H18N2O6S/c1-7(2)14(6-10(15)16)12(17)9-5-11(20-8(9)3)21(18,19)13-4/h5,7,13H,6H2,1-4H3,(H,15,16) |
| InChIKey | WXAPUTWYKHXSKO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |