C14H18N2O4S2 — CID 71860079
2-methyl-5-(methylsulfamoyl)-N-(2-thiophen-3-ylpropyl)furan-3-carboxamide (PubChem CID 71860079) has the molecular formula C14H18N2O4S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-methyl-5-(methylsulfamoyl)-N-(2-thiophen-3-ylpropyl)furan-3-carboxamide.
| Compound Name | 2-methyl-5-(methylsulfamoyl)-N-(2-thiophen-3-ylpropyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 71860079 |
| Molecular Formula | C14H18N2O4S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 2-methyl-5-(methylsulfamoyl)-N-(2-thiophen-3-ylpropyl)furan-3-carboxamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)NCC(C)c2ccsc2)c(C)o1 |
| InChI | InChI=1S/C14H18N2O4S2/c1-9(11-4-5-21-8-11)7-16-14(17)12-6-13(20-10(12)2)22(18,19)15-3/h4-6,8-9,15H,7H2,1-3H3,(H,16,17) |
| InChIKey | GDMIUAJDMLRPQS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |