C19H27N3O4S2 — CID 55660126
N-[2-(diethylamino)-2-thiophen-3-ylethyl]-4-methoxy-3-(methylsulfamoyl)benzamide (PubChem CID 55660126) has the molecular formula C19H27N3O4S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-thiophen-3-ylethyl]-4-methoxy-3-(methylsulfamoyl)benzamide.
| Compound Name | N-[2-(diethylamino)-2-thiophen-3-ylethyl]-4-methoxy-3-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55660126 |
| Molecular Formula | C19H27N3O4S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-[2-(diethylamino)-2-thiophen-3-ylethyl]-4-methoxy-3-(methylsulfamoyl)benzamide |
| SMILES | CCN(CC)C(CNC(=O)c1ccc(OC)c(S(=O)(=O)NC)c1)c1ccsc1 |
| InChI | InChI=1S/C19H27N3O4S2/c1-5-22(6-2)16(15-9-10-27-13-15)12-21-19(23)14-7-8-17(26-4)18(11-14)28(24,25)20-3/h7-11,13,16,20H,5-6,12H2,1-4H3,(H,21,23) |
| InChIKey | CTXFACZSWSHRHL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |