C16H20BrN3OS — CID 39214471
5-bromo-N-[(2S)-2-(diethylamino)-2-thiophen-3-ylethyl]pyridine-3-carboxamide (PubChem CID 39214471) has the molecular formula C16H20BrN3OS and a molecular weight of 382.33 g/mol. Its IUPAC name is 5-bromo-N-[(2S)-2-(diethylamino)-2-thiophen-3-ylethyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[(2S)-2-(diethylamino)-2-thiophen-3-ylethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 39214471 |
| Molecular Formula | C16H20BrN3OS |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 5-bromo-N-[(2S)-2-(diethylamino)-2-thiophen-3-ylethyl]pyridine-3-carboxamide |
| SMILES | CCN(CC)[C@H](CNC(=O)c1cncc(Br)c1)c1ccsc1 |
| InChI | InChI=1S/C16H20BrN3OS/c1-3-20(4-2)15(12-5-6-22-11-12)10-19-16(21)13-7-14(17)9-18-8-13/h5-9,11,15H,3-4,10H2,1-2H3,(H,19,21)/t15-/m1/s1 |
| InChIKey | IJMWDTWGAMMHAR-OAHLLOKOSA-N |
| XLogP | 3.72 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |