C19H25BrN2O3S2 — CID 112827263
2-[(4-bromophenyl)methylsulfonyl]-N-[2-(diethylamino)-2-thiophen-3-ylethyl]acetamide (PubChem CID 112827263) has the molecular formula C19H25BrN2O3S2 and a molecular weight of 473.46 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylsulfonyl]-N-[2-(diethylamino)-2-thiophen-3-ylethyl]acetamide.
| Compound Name | 2-[(4-bromophenyl)methylsulfonyl]-N-[2-(diethylamino)-2-thiophen-3-ylethyl]acetamide |
|---|---|
| PubChem CID | 112827263 |
| Molecular Formula | C19H25BrN2O3S2 |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 2-[(4-bromophenyl)methylsulfonyl]-N-[2-(diethylamino)-2-thiophen-3-ylethyl]acetamide |
| SMILES | CCN(CC)C(CNC(=O)CS(=O)(=O)Cc1ccc(Br)cc1)c1ccsc1 |
| InChI | InChI=1S/C19H25BrN2O3S2/c1-3-22(4-2)18(16-9-10-26-12-16)11-21-19(23)14-27(24,25)13-15-5-7-17(20)8-6-15/h5-10,12,18H,3-4,11,13-14H2,1-2H3,(H,21,23) |
| InChIKey | OALVVPYDIUDFMG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |