C21H24BrN3O3S — CID 55660187
3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(diethylamino)-2-thiophen-3-ylethyl]propanamide (PubChem CID 55660187) has the molecular formula C21H24BrN3O3S and a molecular weight of 478.41 g/mol. Its IUPAC name is 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(diethylamino)-2-thiophen-3-ylethyl]propanamide.
| Compound Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(diethylamino)-2-thiophen-3-ylethyl]propanamide |
|---|---|
| PubChem CID | 55660187 |
| Molecular Formula | C21H24BrN3O3S |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(diethylamino)-2-thiophen-3-ylethyl]propanamide |
| SMILES | CCN(CC)C(CNC(=O)CCN1C(=O)c2ccc(Br)cc2C1=O)c1ccsc1 |
| InChI | InChI=1S/C21H24BrN3O3S/c1-3-24(4-2)18(14-8-10-29-13-14)12-23-19(26)7-9-25-20(27)16-6-5-15(22)11-17(16)21(25)28/h5-6,8,10-11,13,18H,3-4,7,9,12H2,1-2H3,(H,23,26) |
| InChIKey | NISXERYIIFIAJR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|