C17H20BrFN2OS — CID 39212841
2-bromo-N-[(2S)-2-(diethylamino)-2-thiophen-3-ylethyl]-4-fluorobenzamide (PubChem CID 39212841) has the molecular formula C17H20BrFN2OS and a molecular weight of 399.33 g/mol. Its IUPAC name is 2-bromo-N-[(2S)-2-(diethylamino)-2-thiophen-3-ylethyl]-4-fluorobenzamide.
| Compound Name | 2-bromo-N-[(2S)-2-(diethylamino)-2-thiophen-3-ylethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 39212841 |
| Molecular Formula | C17H20BrFN2OS |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2-bromo-N-[(2S)-2-(diethylamino)-2-thiophen-3-ylethyl]-4-fluorobenzamide |
| SMILES | CCN(CC)[C@H](CNC(=O)c1ccc(F)cc1Br)c1ccsc1 |
| InChI | InChI=1S/C17H20BrFN2OS/c1-3-21(4-2)16(12-7-8-23-11-12)10-20-17(22)14-6-5-13(19)9-15(14)18/h5-9,11,16H,3-4,10H2,1-2H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | VBWGYOBCALMJFK-MRXNPFEDSA-N |
| XLogP | 4.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |